C18H19ClN2O — CID 94756196
3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol (PubChem CID 94756196) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol.
| Compound Name | 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 94756196 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol |
| SMILES | Cc1cc2nc(-c3cccc(Cl)c3)n(CCCO)c2cc1C |
| InChI | InChI=1S/C18H19ClN2O/c1-12-9-16-17(10-13(12)2)21(7-4-8-22)18(20-16)14-5-3-6-15(19)11-14/h3,5-6,9-11,22H,4,7-8H2,1-2H3 |
| InChIKey | UMLDRNGPLCVAFD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |