About 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol
3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol (PubChem CID 94756196) has the molecular formula C18H19ClN2O
and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol |
| PubChem CID | 94756196 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol |
| SMILES | Cc1cc2nc(-c3cccc(Cl)c3)n(CCCO)c2cc1C |
| InChI | InChI=1S/C18H19ClN2O/c1-12-9-16-17(10-13(12)2)21(7-4-8-22)18(20-16)14-5-3-6-15(19)11-14/h3,5-6,9-11,22H,4,7-8H2,1-2H3 |
| InChIKey | UMLDRNGPLCVAFD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol?
The IUPAC name of 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol (CID 94756196) is 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol.
What is the SMILES notation for 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol?
The canonical SMILES for 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol is Cc1cc2nc(-c3cccc(Cl)c3)n(CCCO)c2cc1C.
What is the InChIKey of 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol?
The InChIKey is UMLDRNGPLCVAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O/c1-12-9-16-17(10-13(12)2)21(7-4-8-22)18(20-16)14-5-3-6-15(19)11-14/h3,5-6,9-11,22H,4,7-8H2,1-2H3.
What are the key properties of 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol?
3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol has a molecular weight of 314.82 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-chlorophenyl)-5,6-dimethylbenzimidazol-1-yl]propan-1-ol is sourced from PubChem (CID 94756196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).