C15H12N4O3S — CID 9475700
2-[[2-(4-oxocinnolin-1-yl)acetyl]amino]thiophene-3-carboxamide (PubChem CID 9475700) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[[2-(4-oxocinnolin-1-yl)acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-oxocinnolin-1-yl)acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9475700 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-[[2-(4-oxocinnolin-1-yl)acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)Cn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C15H12N4O3S/c16-14(22)10-5-6-23-15(10)18-13(21)8-19-11-4-2-1-3-9(11)12(20)7-17-19/h1-7H,8H2,(H2,16,22)(H,18,21) |
| InChIKey | OWRFVZBUNOIZOK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |