C17H19ClN4 — CID 94758162
4-[(2-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)methyl]aniline (PubChem CID 94758162) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 4-[(2-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)methyl]aniline.
| Compound Name | 4-[(2-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 94758162 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(2-butyl-6-chloroimidazo[4,5-b]pyridin-3-yl)methyl]aniline |
| SMILES | CCCCc1nc2cc(Cl)cnc2n1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C17H19ClN4/c1-2-3-4-16-21-15-9-13(18)10-20-17(15)22(16)11-12-5-7-14(19)8-6-12/h5-10H,2-4,11,19H2,1H3 |
| InChIKey | HIDAKOIDPDTFET-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|