C18H17FN4 — CID 94758757
4-[2-[(4-fluorophenyl)methyl]-6-methylimidazo[4,5-b]pyridin-3-yl]butanenitrile (PubChem CID 94758757) has the molecular formula C18H17FN4 and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methyl]-6-methylimidazo[4,5-b]pyridin-3-yl]butanenitrile.
| Compound Name | 4-[2-[(4-fluorophenyl)methyl]-6-methylimidazo[4,5-b]pyridin-3-yl]butanenitrile |
|---|---|
| PubChem CID | 94758757 |
| Molecular Formula | C18H17FN4 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methyl]-6-methylimidazo[4,5-b]pyridin-3-yl]butanenitrile |
| SMILES | Cc1cnc2c(c1)nc(Cc1ccc(F)cc1)n2CCCC#N |
| InChI | InChI=1S/C18H17FN4/c1-13-10-16-18(21-12-13)23(9-3-2-8-20)17(22-16)11-14-4-6-15(19)7-5-14/h4-7,10,12H,2-3,9,11H2,1H3 |
| InChIKey | FKSCRQXONGLHQL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|