C17H16F2N2O2 — CID 94760327
(Z)-3-(3-amino-4-ethoxyphenyl)-N-(2,5-difluorophenyl)prop-2-enamide (PubChem CID 94760327) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is (Z)-3-(3-amino-4-ethoxyphenyl)-N-(2,5-difluorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-amino-4-ethoxyphenyl)-N-(2,5-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94760327 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (Z)-3-(3-amino-4-ethoxyphenyl)-N-(2,5-difluorophenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C\C(=O)Nc2cc(F)ccc2F)cc1N |
| InChI | InChI=1S/C17H16F2N2O2/c1-2-23-16-7-3-11(9-14(16)20)4-8-17(22)21-15-10-12(18)5-6-13(15)19/h3-10H,2,20H2,1H3,(H,21,22)/b8-4- |
| InChIKey | XEALOPCCZGQVAT-YWEYNIOJSA-N |
| XLogP | 3.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|