C16H21NO5 — CID 94762266
8-ethoxy-4-(3-hydroxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carbaldehyde (PubChem CID 94762266) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 8-ethoxy-4-(3-hydroxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 8-ethoxy-4-(3-hydroxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 94762266 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 8-ethoxy-4-(3-hydroxypropyl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carbaldehyde |
| SMILES | CCOc1cc(C=O)cc2c1OC(C)(C)C(=O)N2CCCO |
| InChI | InChI=1S/C16H21NO5/c1-4-21-13-9-11(10-19)8-12-14(13)22-16(2,3)15(20)17(12)6-5-7-18/h8-10,18H,4-7H2,1-3H3 |
| InChIKey | OWESMMCXXDQURD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|