C22H23N3O3 — CID 9476821
[(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate (PubChem CID 9476821) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9476821 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] (E)-3-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C/C(=O)O[C@H](C)c2nc(-c3ccccc3)no2)c(C)n1C1CC1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-13-18(15(2)25(14)19-10-11-19)9-12-20(26)27-16(3)22-23-21(24-28-22)17-7-5-4-6-8-17/h4-9,12-13,16,19H,10-11H2,1-3H3/b12-9+/t16-/m1/s1 |
| InChIKey | IGLCHHPIJPRBFX-ONOODXEBSA-N |
| XLogP | 4.81 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|