3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid

C13H18O4S — CID 94771142

IUPAC3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid
SMILESCOc1ccc(CCSCCC(=O)O)cc1OC
InChIInChI=1S/C13H18O4S/c1-16-11-4-3-10(9-12(11)17-2)5-7-18-8-6-13(14)15/h3-4,9H,5-8H2,1-2H3,(H,14,15)
InChIKeyGCJJSERBJSXCSE-UHFFFAOYSA-N
MW270.35 g/mol
LogP2.45
Rot. Bonds8

About 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid

3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid (PubChem CID 94771142) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid.

Molecular Properties

Compound Name3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid
PubChem CID94771142
Molecular FormulaC13H18O4S
Molecular Weight270.35 g/mol
Exact Mass270.09
IUPAC Name3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid
SMILESCOc1ccc(CCSCCC(=O)O)cc1OC
InChIInChI=1S/C13H18O4S/c1-16-11-4-3-10(9-12(11)17-2)5-7-18-8-6-13(14)15/h3-4,9H,5-8H2,1-2H3,(H,14,15)
InChIKeyGCJJSERBJSXCSE-UHFFFAOYSA-N
XLogP2.45
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.35
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid (CID 94771142) is 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid is COc1ccc(CCSCCC(=O)O)cc1OC.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid?
The InChIKey is GCJJSERBJSXCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4S/c1-16-11-4-3-10(9-12(11)17-2)5-7-18-8-6-13(14)15/h3-4,9H,5-8H2,1-2H3,(H,14,15).
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid?
3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid has a molecular weight of 270.35 g/mol, XLogP of 2.45, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]propanoic acid is sourced from PubChem (CID 94771142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).