C18H26N4O3S — CID 9477496
1-[[(3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9477496) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[[(3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[(3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9477496 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[[(3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | CCc1ccc(N2C[C@H](C(=O)NNC(=S)N[C@H](C)COC)CC2=O)cc1 |
| InChI | InChI=1S/C18H26N4O3S/c1-4-13-5-7-15(8-6-13)22-10-14(9-16(22)23)17(24)20-21-18(26)19-12(2)11-25-3/h5-8,12,14H,4,9-11H2,1-3H3,(H,20,24)(H2,19,21,26)/t12-,14-/m1/s1 |
| InChIKey | VKWHCFRWAPFXHY-TZMCWYRMSA-N |
| XLogP | 1.13 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|