C16H17N3OS — CID 94775107
[5-(2-ethoxynaphthalen-1-yl)-4-methyl-1,3-thiazol-2-yl]hydrazine (PubChem CID 94775107) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is [5-(2-ethoxynaphthalen-1-yl)-4-methyl-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(2-ethoxynaphthalen-1-yl)-4-methyl-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 94775107 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [5-(2-ethoxynaphthalen-1-yl)-4-methyl-1,3-thiazol-2-yl]hydrazine |
| SMILES | CCOc1ccc2ccccc2c1-c1sc(NN)nc1C |
| InChI | InChI=1S/C16H17N3OS/c1-3-20-13-9-8-11-6-4-5-7-12(11)14(13)15-10(2)18-16(19-17)21-15/h4-9H,3,17H2,1-2H3,(H,18,19) |
| InChIKey | AXSHCLDTFQJJCL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|