About 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol
3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol (PubChem CID 94778853) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol |
| PubChem CID | 94778853 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol |
| SMILES | Cn1c(-c2ccccc2)nc2cc3c(cc21)CN(CCCO)C3 |
| InChI | InChI=1S/C19H21N3O/c1-21-18-11-16-13-22(8-5-9-23)12-15(16)10-17(18)20-19(21)14-6-3-2-4-7-14/h2-4,6-7,10-11,23H,5,8-9,12-13H2,1H3 |
| InChIKey | LPJZZMZDTXTFQU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol?
The IUPAC name of 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol (CID 94778853) is 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol.
What is the SMILES notation for 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol?
The canonical SMILES for 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol is Cn1c(-c2ccccc2)nc2cc3c(cc21)CN(CCCO)C3.
What is the InChIKey of 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol?
The InChIKey is LPJZZMZDTXTFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O/c1-21-18-11-16-13-22(8-5-9-23)12-15(16)10-17(18)20-19(21)14-6-3-2-4-7-14/h2-4,6-7,10-11,23H,5,8-9,12-13H2,1H3.
What are the key properties of 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol?
3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol has a molecular weight of 307.40 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-2-phenyl-5,7-dihydropyrrolo[3,4-f]benzimidazol-6-yl)propan-1-ol is sourced from PubChem (CID 94778853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).