C26H34N2O — CID 94778934
(2S)-2-(4-benzylpiperidin-1-yl)-N-cyclopentyl-2-(4-methylphenyl)acetamide (PubChem CID 94778934) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is (2S)-2-(4-benzylpiperidin-1-yl)-N-cyclopentyl-2-(4-methylphenyl)acetamide.
| Compound Name | (2S)-2-(4-benzylpiperidin-1-yl)-N-cyclopentyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 94778934 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | (2S)-2-(4-benzylpiperidin-1-yl)-N-cyclopentyl-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc([C@@H](C(=O)NC2CCCC2)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O/c1-20-11-13-23(14-12-20)25(26(29)27-24-9-5-6-10-24)28-17-15-22(16-18-28)19-21-7-3-2-4-8-21/h2-4,7-8,11-14,22,24-25H,5-6,9-10,15-19H2,1H3,(H,27,29)/t25-/m0/s1 |
| InChIKey | YMGNMILANIBKAG-VWLOTQADSA-N |
| XLogP | 5.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |