About ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate
ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate (PubChem CID 94779819) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate |
| PubChem CID | 94779819 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NC(=O)c1ccc(N2CCC(C)=N2)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-4-22-16(21)12(3)17-15(20)13-5-7-14(8-6-13)19-10-9-11(2)18-19/h5-8,12H,4,9-10H2,1-3H3,(H,17,20)/t12-/m1/s1 |
| InChIKey | IXXOGMPQOWMACA-GFCCVEGCSA-N |
| XLogP | 1.95 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate?
The IUPAC name of ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate (CID 94779819) is ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate.
What is the SMILES notation for ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate?
The canonical SMILES for ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate is CCOC(=O)[C@@H](C)NC(=O)c1ccc(N2CCC(C)=N2)cc1.
What is the InChIKey of ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate?
The InChIKey is IXXOGMPQOWMACA-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-4-22-16(21)12(3)17-15(20)13-5-7-14(8-6-13)19-10-9-11(2)18-19/h5-8,12H,4,9-10H2,1-3H3,(H,17,20)/t12-/m1/s1.
What are the key properties of ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate?
ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate has a molecular weight of 303.36 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[[4-(5-methyl-3,4-dihydropyrazol-2-yl)benzoyl]amino]propanoate is sourced from PubChem (CID 94779819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).