About N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide (PubChem CID 9478044) has the molecular formula C20H25FN2O5S
and a molecular weight of 424.49 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide |
| PubChem CID | 9478044 |
| Molecular Formula | C20H25FN2O5S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H25FN2O5S/c1-14(18-13-16(27-2)8-11-19(18)28-3)23-20(24)5-4-12-22-29(25,26)17-9-6-15(21)7-10-17/h6-11,13-14,22H,4-5,12H2,1-3H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | QGCAYHMXQQIRBU-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide?
The IUPAC name of N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide (CID 9478044) is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide.
What is the SMILES notation for N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide?
The canonical SMILES for N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide is COc1ccc(OC)c([C@H](C)NC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)c1.
What is the InChIKey of N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide?
The InChIKey is QGCAYHMXQQIRBU-AWEZNQCLSA-N. The full InChI is InChI=1S/C20H25FN2O5S/c1-14(18-13-16(27-2)8-11-19(18)28-3)23-20(24)5-4-12-22-29(25,26)17-9-6-15(21)7-10-17/h6-11,13-14,22H,4-5,12H2,1-3H3,(H,23,24)/t14-/m0/s1.
What are the key properties of N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide?
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide has a molecular weight of 424.49 g/mol, XLogP of 2.78, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide is sourced from PubChem (CID 9478044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).