C14H13N5 — CID 947806
8-ethyl-4-methyl-2,3,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,7,10,12,14-heptaene (PubChem CID 947806) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 8-ethyl-4-methyl-2,3,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,7,10,12,14-heptaene.
| Compound Name | 8-ethyl-4-methyl-2,3,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 947806 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 8-ethyl-4-methyl-2,3,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,7,10,12,14-heptaene |
| SMILES | CCc1nc2cc(C)nn2c2nc3ccccc3n12 |
| InChI | InChI=1S/C14H13N5/c1-3-12-16-13-8-9(2)17-19(13)14-15-10-6-4-5-7-11(10)18(12)14/h4-8H,3H2,1-2H3 |
| InChIKey | WCLXSBNGFKBQMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |