C16H19FN2O5 — CID 94780655
1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-fluoro-4-nitrophenoxy)ethanone (PubChem CID 94780655) has the molecular formula C16H19FN2O5 and a molecular weight of 338.34 g/mol. Its IUPAC name is 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-fluoro-4-nitrophenoxy)ethanone.
| Compound Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-fluoro-4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 94780655 |
| Molecular Formula | C16H19FN2O5 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-fluoro-4-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])c(F)c1)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H19FN2O5/c17-12-9-11(5-6-13(12)19(21)22)24-10-16(20)18-7-8-23-15-4-2-1-3-14(15)18/h5-6,9,14-15H,1-4,7-8,10H2/t14-,15-/m1/s1 |
| InChIKey | SAPLKQXZHKBUNK-HUUCEWRRSA-N |
| XLogP | 2.28 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|