C19H29N3O2 — CID 94784827
1-[(2R)-heptan-2-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea (PubChem CID 94784827) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(2R)-heptan-2-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[(2R)-heptan-2-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 94784827 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(2R)-heptan-2-yl]-3-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]urea |
| SMILES | CCCCC[C@@H](C)NC(=O)Nc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-3-4-5-8-15(2)20-19(24)21-17-10-6-9-16(13-17)14-22-12-7-11-18(22)23/h6,9-10,13,15H,3-5,7-8,11-12,14H2,1-2H3,(H2,20,21,24)/t15-/m1/s1 |
| InChIKey | DLYARRZIAYXUOD-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|