C15H18ClN5O3S2 — CID 9478713
1-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9478713) has the molecular formula C15H18ClN5O3S2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 1-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9478713 |
| Molecular Formula | C15H18ClN5O3S2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1-[[2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@@H](C)NC(=S)NNC(=O)CSc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H18ClN5O3S2/c1-9(7-23-2)17-14(25)20-18-12(22)8-26-15-21-19-13(24-15)10-5-3-4-6-11(10)16/h3-6,9H,7-8H2,1-2H3,(H,18,22)(H2,17,20,25)/t9-/m1/s1 |
| InChIKey | QSTOQCYWTAUSMZ-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|