C15H20N4O3 — CID 94792411
1-[(3S)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]imidazolidin-2-one (PubChem CID 94792411) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[(3S)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]imidazolidin-2-one.
| Compound Name | 1-[(3S)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 94792411 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[(3S)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]imidazolidin-2-one |
| SMILES | O=C1NCCN1[C@H]1CCCN(Cc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H20N4O3/c20-15-16-7-9-18(15)13-5-3-8-17(11-13)10-12-4-1-2-6-14(12)19(21)22/h1-2,4,6,13H,3,5,7-11H2,(H,16,20)/t13-/m0/s1 |
| InChIKey | NMKRLEQKFNDMMW-ZDUSSCGKSA-N |
| XLogP | 1.58 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|