C16H24N4O4 — CID 94796559
(2R)-2-[2-[2-(dimethylamino)-2-oxoethoxy]-4-methylanilino]-N-(methylcarbamoyl)propanamide (PubChem CID 94796559) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2R)-2-[2-[2-(dimethylamino)-2-oxoethoxy]-4-methylanilino]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[2-[2-(dimethylamino)-2-oxoethoxy]-4-methylanilino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 94796559 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (2R)-2-[2-[2-(dimethylamino)-2-oxoethoxy]-4-methylanilino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)Nc1ccc(C)cc1OCC(=O)N(C)C |
| InChI | InChI=1S/C16H24N4O4/c1-10-6-7-12(13(8-10)24-9-14(21)20(4)5)18-11(2)15(22)19-16(23)17-3/h6-8,11,18H,9H2,1-5H3,(H2,17,19,22,23)/t11-/m1/s1 |
| InChIKey | IWIMBMHXUCBMEF-LLVKDONJSA-N |
| XLogP | 0.72 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |