C15H18F2N2OS — CID 94796573
N-[(3S)-1-cyclopropylpyrrolidin-3-yl]-4-(difluoromethylsulfanyl)benzamide (PubChem CID 94796573) has the molecular formula C15H18F2N2OS and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[(3S)-1-cyclopropylpyrrolidin-3-yl]-4-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-[(3S)-1-cyclopropylpyrrolidin-3-yl]-4-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 94796573 |
| Molecular Formula | C15H18F2N2OS |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[(3S)-1-cyclopropylpyrrolidin-3-yl]-4-(difluoromethylsulfanyl)benzamide |
| SMILES | O=C(N[C@H]1CCN(C2CC2)C1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H18F2N2OS/c16-15(17)21-13-5-1-10(2-6-13)14(20)18-11-7-8-19(9-11)12-3-4-12/h1-2,5-6,11-12,15H,3-4,7-9H2,(H,18,20)/t11-/m0/s1 |
| InChIKey | YFUFSBJCDOUVGH-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |