C16H21N3O4 — CID 94796869
(2R)-2-(4-acetyl-2-nitroanilino)-N-cyclopentylpropanamide (PubChem CID 94796869) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2R)-2-(4-acetyl-2-nitroanilino)-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-(4-acetyl-2-nitroanilino)-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 94796869 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2R)-2-(4-acetyl-2-nitroanilino)-N-cyclopentylpropanamide |
| SMILES | CC(=O)c1ccc(N[C@H](C)C(=O)NC2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O4/c1-10(16(21)18-13-5-3-4-6-13)17-14-8-7-12(11(2)20)9-15(14)19(22)23/h7-10,13,17H,3-6H2,1-2H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | LJQGCQATCWWSJZ-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|