C19H28N2O4 — CID 94797465
2-[2-methoxy-4-[(4R)-4-propylazepane-1-carbonyl]phenoxy]acetamide (PubChem CID 94797465) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(4R)-4-propylazepane-1-carbonyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[(4R)-4-propylazepane-1-carbonyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 94797465 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[2-methoxy-4-[(4R)-4-propylazepane-1-carbonyl]phenoxy]acetamide |
| SMILES | CCC[C@@H]1CCCN(C(=O)c2ccc(OCC(N)=O)c(OC)c2)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-3-5-14-6-4-10-21(11-9-14)19(23)15-7-8-16(17(12-15)24-2)25-13-18(20)22/h7-8,12,14H,3-6,9-11,13H2,1-2H3,(H2,20,22)/t14-/m1/s1 |
| InChIKey | SWJZNJJCIQLQRX-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |