C18H14N2O3 — CID 94797600
(3R)-N-(1H-indol-4-yl)-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 94797600) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is (3R)-N-(1H-indol-4-yl)-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | (3R)-N-(1H-indol-4-yl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 94797600 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-N-(1H-indol-4-yl)-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | O=C1O[C@@H](C(=O)Nc2cccc3[nH]ccc23)Cc2ccccc21 |
| InChI | InChI=1S/C18H14N2O3/c21-17(20-15-7-3-6-14-13(15)8-9-19-14)16-10-11-4-1-2-5-12(11)18(22)23-16/h1-9,16,19H,10H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | YVZFSLZDYLVQOL-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |