C18H21F3N2O2 — CID 94798233
1-[(5S)-3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-phenylethanone (PubChem CID 94798233) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[(5S)-3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-phenylethanone.
| Compound Name | 1-[(5S)-3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 94798233 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(5S)-3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1N=C(C2CCCCC2)C[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C18H21F3N2O2/c19-18(20,21)17(25)12-15(14-9-5-2-6-10-14)22-23(17)16(24)11-13-7-3-1-4-8-13/h1,3-4,7-8,14,25H,2,5-6,9-12H2/t17-/m0/s1 |
| InChIKey | AIUJZLGMVOLANN-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |