C25H26N4O2 — CID 94798267
(4S)-2-amino-7,7-dimethyl-4-(4-methylphenyl)-1-(4-nitrophenyl)-4,5,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 94798267) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (4S)-2-amino-7,7-dimethyl-4-(4-methylphenyl)-1-(4-nitrophenyl)-4,5,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-7,7-dimethyl-4-(4-methylphenyl)-1-(4-nitrophenyl)-4,5,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 94798267 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (4S)-2-amino-7,7-dimethyl-4-(4-methylphenyl)-1-(4-nitrophenyl)-4,5,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccc([C@@H]2C(C#N)=C(N)N(c3ccc([N+](=O)[O-])cc3)C3=C2CCC(C)(C)C3)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-16-4-6-17(7-5-16)23-20-12-13-25(2,3)14-22(20)28(24(27)21(23)15-26)18-8-10-19(11-9-18)29(30)31/h4-11,23H,12-14,27H2,1-3H3/t23-/m0/s1 |
| InChIKey | PNHMHMIDGQSGPQ-QHCPKHFHSA-N |
| XLogP | 5.67 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|