C15H19ClN2O4 — CID 94799711
3-chloro-4-ethoxy-5-methoxy-N-[(3S)-2-oxopiperidin-3-yl]benzamide (PubChem CID 94799711) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[(3S)-2-oxopiperidin-3-yl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[(3S)-2-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 94799711 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[(3S)-2-oxopiperidin-3-yl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)N[C@H]2CCCNC2=O)cc1OC |
| InChI | InChI=1S/C15H19ClN2O4/c1-3-22-13-10(16)7-9(8-12(13)21-2)14(19)18-11-5-4-6-17-15(11)20/h7-8,11H,3-6H2,1-2H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | ASJPWFHINASDTJ-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |