C17H23NO5 — CID 94801002
methyl (2S)-2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-methylbutanoate (PubChem CID 94801002) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl (2S)-2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 94801002 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl (2S)-2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-methylbutanoate |
| SMILES | CC[C@](C)(NC(=O)/C=C/c1cc(OC)cc(OC)c1)C(=O)OC |
| InChI | InChI=1S/C17H23NO5/c1-6-17(2,16(20)23-5)18-15(19)8-7-12-9-13(21-3)11-14(10-12)22-4/h7-11H,6H2,1-5H3,(H,18,19)/b8-7+/t17-/m0/s1 |
| InChIKey | VOOZMCNHAZFTIM-OZSKJFCKSA-N |
| XLogP | 2.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|