C12H16N2O4S — CID 9480838
N-[2-(dimethylamino)-2-oxoethyl]-4-methylsulfonylbenzamide (PubChem CID 9480838) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 9480838 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-4-methylsulfonylbenzamide |
| SMILES | CN(C)C(=O)CNC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O4S/c1-14(2)11(15)8-13-12(16)9-4-6-10(7-5-9)19(3,17)18/h4-7H,8H2,1-3H3,(H,13,16) |
| InChIKey | XPWFNOYHPWZQDM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |