C18H18N4O2 — CID 94810471
(2S)-N-[(2-phenoxyphenyl)methyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 94810471) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (2S)-N-[(2-phenoxyphenyl)methyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | (2S)-N-[(2-phenoxyphenyl)methyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 94810471 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2S)-N-[(2-phenoxyphenyl)methyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccccc1Oc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C18H18N4O2/c1-14(22-13-19-12-21-22)18(23)20-11-15-7-5-6-10-17(15)24-16-8-3-2-4-9-16/h2-10,12-14H,11H2,1H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | YYHDMYMQEDBBPN-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |