C16H23NO5 — CID 94811894
methyl (2R)-2-[[2-(2-methoxyethoxy)benzoyl]amino]-2-methylbutanoate (PubChem CID 94811894) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(2-methoxyethoxy)benzoyl]amino]-2-methylbutanoate.
| Compound Name | methyl (2R)-2-[[2-(2-methoxyethoxy)benzoyl]amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 94811894 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl (2R)-2-[[2-(2-methoxyethoxy)benzoyl]amino]-2-methylbutanoate |
| SMILES | CC[C@@](C)(NC(=O)c1ccccc1OCCOC)C(=O)OC |
| InChI | InChI=1S/C16H23NO5/c1-5-16(2,15(19)21-4)17-14(18)12-8-6-7-9-13(12)22-11-10-20-3/h6-9H,5,10-11H2,1-4H3,(H,17,18)/t16-/m1/s1 |
| InChIKey | CJJJKCTYLBOFSO-MRXNPFEDSA-N |
| XLogP | 1.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|