C16H19FN2OS — CID 94814821
N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetamide (PubChem CID 94814821) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetamide.
| Compound Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 94814821 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetamide |
| SMILES | C[C@H](SCC(=O)N[C@@](C)(C#N)C1CC1)c1ccccc1F |
| InChI | InChI=1S/C16H19FN2OS/c1-11(13-5-3-4-6-14(13)17)21-9-15(20)19-16(2,10-18)12-7-8-12/h3-6,11-12H,7-9H2,1-2H3,(H,19,20)/t11-,16-/m0/s1 |
| InChIKey | PCKOXIRVSRYSTD-ZBEGNZNMSA-N |
| XLogP | 3.43 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |