C15H18N4O2S — CID 94815064
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 94815064) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 94815064 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2cnn(C[C@H]3CCCO3)c2)cs1 |
| InChI | InChI=1S/C15H18N4O2S/c1-11-17-12(10-22-11)4-5-15(20)18-13-7-16-19(8-13)9-14-3-2-6-21-14/h4-5,7-8,10,14H,2-3,6,9H2,1H3,(H,18,20)/b5-4+/t14-/m1/s1 |
| InChIKey | TZANJUJECMKZKQ-ISZGNANSSA-N |
| XLogP | 2.48 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|