About 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide
1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide (PubChem CID 94815174) has the molecular formula C14H14F3N3O2S
and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide |
| PubChem CID | 94815174 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)N[C@@H]2C[C@H]2c2ccccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H14F3N3O2S/c1-20-8-9(7-18-20)23(21,22)19-13-6-11(13)10-4-2-3-5-12(10)14(15,16)17/h2-5,7-8,11,13,19H,6H2,1H3/t11-,13+/m0/s1 |
| InChIKey | GILXADCDHCGPRF-WCQYABFASA-N |
| XLogP | 2.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide?
The IUPAC name of 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide (CID 94815174) is 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide is Cn1cc(S(=O)(=O)N[C@@H]2C[C@H]2c2ccccc2C(F)(F)F)cn1.
What is the InChIKey of 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide?
The InChIKey is GILXADCDHCGPRF-WCQYABFASA-N. The full InChI is InChI=1S/C14H14F3N3O2S/c1-20-8-9(7-18-20)23(21,22)19-13-6-11(13)10-4-2-3-5-12(10)14(15,16)17/h2-5,7-8,11,13,19H,6H2,1H3/t11-,13+/m0/s1.
What are the key properties of 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide?
1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide has a molecular weight of 345.35 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropyl]pyrazole-4-sulfonamide is sourced from PubChem (CID 94815174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).