C15H15F3N2O2S — CID 94818609
(2R)-2-methyl-3-oxo-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 94818609) has the molecular formula C15H15F3N2O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is (2R)-2-methyl-3-oxo-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2R)-2-methyl-3-oxo-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 94818609 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2R)-2-methyl-3-oxo-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | C=CCN(CC(F)(F)F)C(=O)c1ccc2c(c1)NC(=O)[C@@H](C)S2 |
| InChI | InChI=1S/C15H15F3N2O2S/c1-3-6-20(8-15(16,17)18)14(22)10-4-5-12-11(7-10)19-13(21)9(2)23-12/h3-5,7,9H,1,6,8H2,2H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | ZDCYIFQRYMKQFG-SECBINFHSA-N |
| XLogP | 3.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|