C16H21FN2O3 — CID 94820192
N-[2-[ethyl-[[(3S)-oxolan-3-yl]methyl]amino]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 94820192) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is N-[2-[ethyl-[[(3S)-oxolan-3-yl]methyl]amino]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[ethyl-[[(3S)-oxolan-3-yl]methyl]amino]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94820192 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[2-[ethyl-[[(3S)-oxolan-3-yl]methyl]amino]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | CCN(C[C@@H]1CCOC1)C(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O3/c1-2-19(10-12-7-8-22-11-12)15(20)9-18-16(21)13-3-5-14(17)6-4-13/h3-6,12H,2,7-11H2,1H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | LSSWFCWBRKQFAC-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |