C19H28N2O2 — CID 94820446
(Z)-2-methyl-N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]pent-2-enamide (PubChem CID 94820446) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (Z)-2-methyl-N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]pent-2-enamide.
| Compound Name | (Z)-2-methyl-N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 94820446 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (Z)-2-methyl-N-[[3-[[(2R)-2-methylmorpholin-4-yl]methyl]phenyl]methyl]pent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCc1cccc(CN2CCO[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-6-15(2)19(22)20-12-17-7-5-8-18(11-17)14-21-9-10-23-16(3)13-21/h5-8,11,16H,4,9-10,12-14H2,1-3H3,(H,20,22)/b15-6-/t16-/m1/s1 |
| InChIKey | HXYGXDVILUDKGV-OBHDYHNASA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|