C15H23NO3 — CID 94821099
3-(3,4-dimethylphenoxy)-N-[(2R)-1-methoxypropan-2-yl]propanamide (PubChem CID 94821099) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)-N-[(2R)-1-methoxypropan-2-yl]propanamide.
| Compound Name | 3-(3,4-dimethylphenoxy)-N-[(2R)-1-methoxypropan-2-yl]propanamide |
|---|---|
| PubChem CID | 94821099 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-(3,4-dimethylphenoxy)-N-[(2R)-1-methoxypropan-2-yl]propanamide |
| SMILES | COC[C@@H](C)NC(=O)CCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H23NO3/c1-11-5-6-14(9-12(11)2)19-8-7-15(17)16-13(3)10-18-4/h5-6,9,13H,7-8,10H2,1-4H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | CEJLWLIGDWBOBE-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |