About (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide
(2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide (PubChem CID 94821802) has the molecular formula C17H24N4O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide |
| PubChem CID | 94821802 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide |
| SMILES | Cc1nn(C)c(Oc2ccccc2)c1CN[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C17H24N4O2/c1-12-15(11-18-13(2)16(22)20(3)4)17(21(5)19-12)23-14-9-7-6-8-10-14/h6-10,13,18H,11H2,1-5H3/t13-/m1/s1 |
| InChIKey | GPPQAQGPLRDMQQ-CYBMUJFWSA-N |
| XLogP | 2.09 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide?
The IUPAC name of (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide (CID 94821802) is (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide.
What is the SMILES notation for (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide?
The canonical SMILES for (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide is Cc1nn(C)c(Oc2ccccc2)c1CN[C@H](C)C(=O)N(C)C.
What is the InChIKey of (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide?
The InChIKey is GPPQAQGPLRDMQQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H24N4O2/c1-12-15(11-18-13(2)16(22)20(3)4)17(21(5)19-12)23-14-9-7-6-8-10-14/h6-10,13,18H,11H2,1-5H3/t13-/m1/s1.
What are the key properties of (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide?
(2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide has a molecular weight of 316.40 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide is sourced from PubChem (CID 94821802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).