C19H19N3O2 — CID 94822827
(2R)-N-[(2S)-2-hydroxy-2-phenylethyl]-2-phenyl-2-pyrazol-1-ylacetamide (PubChem CID 94822827) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R)-N-[(2S)-2-hydroxy-2-phenylethyl]-2-phenyl-2-pyrazol-1-ylacetamide.
| Compound Name | (2R)-N-[(2S)-2-hydroxy-2-phenylethyl]-2-phenyl-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 94822827 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (2R)-N-[(2S)-2-hydroxy-2-phenylethyl]-2-phenyl-2-pyrazol-1-ylacetamide |
| SMILES | O=C(NC[C@@H](O)c1ccccc1)[C@@H](c1ccccc1)n1cccn1 |
| InChI | InChI=1S/C19H19N3O2/c23-17(15-8-3-1-4-9-15)14-20-19(24)18(22-13-7-12-21-22)16-10-5-2-6-11-16/h1-13,17-18,23H,14H2,(H,20,24)/t17-,18-/m1/s1 |
| InChIKey | NZZWASIBTHZLBC-QZTJIDSGSA-N |
| XLogP | 2.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |