C18H26N4O — CID 94823238
N,N,1,3-tetramethyl-4-[[[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]amino]methyl]pyrazol-5-amine (PubChem CID 94823238) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is N,N,1,3-tetramethyl-4-[[[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]amino]methyl]pyrazol-5-amine.
| Compound Name | N,N,1,3-tetramethyl-4-[[[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]amino]methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 94823238 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N,N,1,3-tetramethyl-4-[[[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]amino]methyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(N(C)C)c1CN[C@H]1CCCOc2ccccc21 |
| InChI | InChI=1S/C18H26N4O/c1-13-15(18(21(2)3)22(4)20-13)12-19-16-9-7-11-23-17-10-6-5-8-14(16)17/h5-6,8,10,16,19H,7,9,11-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | OYNCDYOBUYPSOP-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |