C17H22FNO2 — CID 94823425
2-cyclopentyl-1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethanone (PubChem CID 94823425) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-cyclopentyl-1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 94823425 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-cyclopentyl-1-[(2S)-2-(4-fluorophenyl)morpholin-4-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1CCO[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H22FNO2/c18-15-7-5-14(6-8-15)16-12-19(9-10-21-16)17(20)11-13-3-1-2-4-13/h5-8,13,16H,1-4,9-12H2/t16-/m1/s1 |
| InChIKey | JQSVZMCHHOJAFB-MRXNPFEDSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |