C15H26N4O — CID 94823486
N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-1H-pyrazole-5-carboxamide (PubChem CID 94823486) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 94823486 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-1H-pyrazole-5-carboxamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCCNC(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C15H26N4O/c1-12-9-13(2)11-19(10-12)8-4-3-6-16-15(20)14-5-7-17-18-14/h5,7,12-13H,3-4,6,8-11H2,1-2H3,(H,16,20)(H,17,18)/t12-,13+ |
| InChIKey | OSTUWZSGCHOBBK-BETUJISGSA-N |
| XLogP | 1.90 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|