C17H19N3O4 — CID 94824432
N-[(2R)-oxan-2-yl]oxy-2-(6-oxo-3-phenylpyridazin-1-yl)acetamide (PubChem CID 94824432) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[(2R)-oxan-2-yl]oxy-2-(6-oxo-3-phenylpyridazin-1-yl)acetamide.
| Compound Name | N-[(2R)-oxan-2-yl]oxy-2-(6-oxo-3-phenylpyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 94824432 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[(2R)-oxan-2-yl]oxy-2-(6-oxo-3-phenylpyridazin-1-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)ccc1=O)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C17H19N3O4/c21-15(19-24-17-8-4-5-11-23-17)12-20-16(22)10-9-14(18-20)13-6-2-1-3-7-13/h1-3,6-7,9-10,17H,4-5,8,11-12H2,(H,19,21)/t17-/m1/s1 |
| InChIKey | PUQRVAQNHLSVSD-QGZVFWFLSA-N |
| XLogP | 1.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|