About N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide
N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 94825823) has the molecular formula C13H18F2N2O3
and a molecular weight of 288.29 g/mol. Its IUPAC name is N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide |
| PubChem CID | 94825823 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | CCCN(CC(F)F)C(=O)[C@@H](C)NC(=O)c1ccoc1 |
| InChI | InChI=1S/C13H18F2N2O3/c1-3-5-17(7-11(14)15)13(19)9(2)16-12(18)10-4-6-20-8-10/h4,6,8-9,11H,3,5,7H2,1-2H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | LTQKWCYHKYDMAY-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide?
The IUPAC name of N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide (CID 94825823) is N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide.
What is the SMILES notation for N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide?
The canonical SMILES for N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide is CCCN(CC(F)F)C(=O)[C@@H](C)NC(=O)c1ccoc1.
What is the InChIKey of N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide?
The InChIKey is LTQKWCYHKYDMAY-SECBINFHSA-N. The full InChI is InChI=1S/C13H18F2N2O3/c1-3-5-17(7-11(14)15)13(19)9(2)16-12(18)10-4-6-20-8-10/h4,6,8-9,11H,3,5,7H2,1-2H3,(H,16,18)/t9-/m1/s1.
What are the key properties of N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide?
N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide has a molecular weight of 288.29 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-[2,2-difluoroethyl(propyl)amino]-1-oxopropan-2-yl]furan-3-carboxamide is sourced from PubChem (CID 94825823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).