About (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile
(3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile (PubChem CID 94828068) has the molecular formula C12H14F2N2
and a molecular weight of 224.25 g/mol. Its IUPAC name is (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile.
Molecular Properties
| Compound Name | (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile |
| PubChem CID | 94828068 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile |
| SMILES | C[C@@H](CC#N)N(C)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2/c1-9(5-6-15)16(2)8-10-3-4-11(13)7-12(10)14/h3-4,7,9H,5,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | LTCUGWAVOCYJGF-VIFPVBQESA-N |
| XLogP | 2.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile?
The IUPAC name of (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile (CID 94828068) is (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile.
What is the SMILES notation for (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile?
The canonical SMILES for (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile is C[C@@H](CC#N)N(C)Cc1ccc(F)cc1F.
What is the InChIKey of (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile?
The InChIKey is LTCUGWAVOCYJGF-VIFPVBQESA-N. The full InChI is InChI=1S/C12H14F2N2/c1-9(5-6-15)16(2)8-10-3-4-11(13)7-12(10)14/h3-4,7,9H,5,8H2,1-2H3/t9-/m0/s1.
What are the key properties of (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile?
(3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile has a molecular weight of 224.25 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(2,4-difluorophenyl)methyl-methylamino]butanenitrile is sourced from PubChem (CID 94828068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).