C15H14N2O3S2 — CID 94828409
5-[(1S)-1-benzylsulfonylethyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 94828409) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-[(1S)-1-benzylsulfonylethyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(1S)-1-benzylsulfonylethyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 94828409 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-[(1S)-1-benzylsulfonylethyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | C[C@@H](c1nc(-c2cccs2)no1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-11(22(18,19)10-12-6-3-2-4-7-12)15-16-14(17-20-15)13-8-5-9-21-13/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | GUIYBXXOLFDPSX-NSHDSACASA-N |
| XLogP | 3.47 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |