About 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea
1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea (PubChem CID 94828669) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea.
Molecular Properties
| Compound Name | 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea |
| PubChem CID | 94828669 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea |
| SMILES | COCCn1ncc2ccc(NC(=O)N[C@H]3COc4ccccc43)cc21 |
| InChI | InChI=1S/C19H20N4O3/c1-25-9-8-23-17-10-14(7-6-13(17)11-20-23)21-19(24)22-16-12-26-18-5-3-2-4-15(16)18/h2-7,10-11,16H,8-9,12H2,1H3,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | PLLXLKGODHKGBW-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea?
The IUPAC name of 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea (CID 94828669) is 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea.
What is the SMILES notation for 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea?
The canonical SMILES for 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea is COCCn1ncc2ccc(NC(=O)N[C@H]3COc4ccccc43)cc21.
What is the InChIKey of 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea?
The InChIKey is PLLXLKGODHKGBW-INIZCTEOSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-25-9-8-23-17-10-14(7-6-13(17)11-20-23)21-19(24)22-16-12-26-18-5-3-2-4-15(16)18/h2-7,10-11,16H,8-9,12H2,1H3,(H2,21,22,24)/t16-/m0/s1.
What are the key properties of 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea?
1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea has a molecular weight of 352.39 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-2,3-dihydro-1-benzofuran-3-yl]-3-[1-(2-methoxyethyl)indazol-6-yl]urea is sourced from PubChem (CID 94828669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).