C18H16FN3O5 — CID 94832671
methyl 2-[4-[(Z)-[[2-(2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 94832671) has the molecular formula C18H16FN3O5 and a molecular weight of 373.34 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 94832671 |
| Molecular Formula | C18H16FN3O5 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(2-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N\NC(=O)C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H16FN3O5/c1-26-16(23)11-27-13-8-6-12(7-9-13)10-20-22-18(25)17(24)21-15-5-3-2-4-14(15)19/h2-10H,11H2,1H3,(H,21,24)(H,22,25)/b20-10- |
| InChIKey | HFMGTINWYWCNMB-JMIUGGIZSA-N |
| XLogP | 1.47 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|