C25H23ClN4O6 — CID 94832886
N-(5-chloro-2-methoxyphenyl)-N'-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 94832886) has the molecular formula C25H23ClN4O6 and a molecular weight of 510.93 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N'-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N'-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94832886 |
| Molecular Formula | C25H23ClN4O6 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N'-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)Nc3cc(Cl)ccc3OC)cc2)cc1 |
| InChI | InChI=1S/C25H23ClN4O6/c1-34-19-10-6-18(7-11-19)28-23(31)15-36-20-8-3-16(4-9-20)14-27-30-25(33)24(32)29-21-13-17(26)5-12-22(21)35-2/h3-14H,15H2,1-2H3,(H,28,31)(H,29,32)(H,30,33)/b27-14- |
| InChIKey | IKPKTQSBDHKZLP-VYYCAZPPSA-N |
| XLogP | 3.46 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|